C16H26 — CID 142426678
5-(5-cyclopentylpentyl)cyclohexa-1,3-diene (PubChem CID 142426678) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 5-(5-cyclopentylpentyl)cyclohexa-1,3-diene.
| Compound Name | 5-(5-cyclopentylpentyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142426678 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 5-(5-cyclopentylpentyl)cyclohexa-1,3-diene |
| SMILES | C1=CCC(CCCCCC2CCCC2)C=C1 |
| InChI | InChI=1S/C16H26/c1-3-9-15(10-4-1)11-5-2-6-12-16-13-7-8-14-16/h1,3-4,9,15-16H,2,5-8,10-14H2 |
| InChIKey | ITNNRTDQSWDZLW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|