C19H35N3 — CID 175505536
5-octylcyclohexa-1,3-diene;propane;2H-triazole (PubChem CID 175505536) has the molecular formula C19H35N3 and a molecular weight of 305.51 g/mol. Its IUPAC name is 5-octylcyclohexa-1,3-diene;propane;2H-triazole.
| Compound Name | 5-octylcyclohexa-1,3-diene;propane;2H-triazole |
|---|---|
| PubChem CID | 175505536 |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.28 |
| IUPAC Name | 5-octylcyclohexa-1,3-diene;propane;2H-triazole |
| SMILES | CCC.CCCCCCCCC1C=CC=CC1.c1cn[nH]n1 |
| InChI | InChI=1S/C14H24.C3H8.C2H3N3/c1-2-3-4-5-6-8-11-14-12-9-7-10-13-14;1-3-2;1-2-4-5-3-1/h7,9-10,12,14H,2-6,8,11,13H2,1H3;3H2,1-2H3;1-2H,(H,3,4,5) |
| InChIKey | HVLCCNIFQQIEKY-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|