C16H34N4O2 — CID 142427585
2-amino-1-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]ethanone;N,N-dimethylformamide;methane (PubChem CID 142427585) has the molecular formula C16H34N4O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-amino-1-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]ethanone;N,N-dimethylformamide;methane.
| Compound Name | 2-amino-1-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]ethanone;N,N-dimethylformamide;methane |
|---|---|
| PubChem CID | 142427585 |
| Molecular Formula | C16H34N4O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | 2-amino-1-[4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]ethanone;N,N-dimethylformamide;methane |
| SMILES | C.CN(C)C=O.NCC(=O)N1CCC(CN2CCCC2)CC1 |
| InChI | InChI=1S/C12H23N3O.C3H7NO.CH4/c13-9-12(16)15-7-3-11(4-8-15)10-14-5-1-2-6-14;1-4(2)3-5;/h11H,1-10,13H2;3H,1-2H3;1H4 |
| InChIKey | JMJFMCYZJCSOEL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|