C11H21N3O — CID 61059386
4-(pyrrolidin-1-ylmethyl)piperidine-1-carboxamide (PubChem CID 61059386) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 4-(pyrrolidin-1-ylmethyl)piperidine-1-carboxamide.
| Compound Name | 4-(pyrrolidin-1-ylmethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 61059386 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 4-(pyrrolidin-1-ylmethyl)piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(CN2CCCC2)CC1 |
| InChI | InChI=1S/C11H21N3O/c12-11(15)14-7-3-10(4-8-14)9-13-5-1-2-6-13/h10H,1-9H2,(H2,12,15) |
| InChIKey | WRVULMHTEUNIKT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |