C13H13N — CID 142428627
N-phenylcyclohepta-1,4,6-trien-1-amine (PubChem CID 142428627) has the molecular formula C13H13N and a molecular weight of 183.25 g/mol. Its IUPAC name is N-phenylcyclohepta-1,4,6-trien-1-amine.
| Compound Name | N-phenylcyclohepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 142428627 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | N-phenylcyclohepta-1,4,6-trien-1-amine |
| SMILES | C1=CCC=C(Nc2ccccc2)C=C1 |
| InChI | InChI=1S/C13H13N/c1-2-5-9-12(8-4-1)14-13-10-6-3-7-11-13/h1-4,6-11,14H,5H2 |
| InChIKey | KDLZTQWCUAFVOK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |