C19H18ClN3O — CID 142429119
3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-methyl-N-phenylbenzamide (PubChem CID 142429119) has the molecular formula C19H18ClN3O and a molecular weight of 339.83 g/mol. Its IUPAC name is 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-methyl-N-phenylbenzamide.
| Compound Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 142429119 |
| Molecular Formula | C19H18ClN3O |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-methyl-N-phenylbenzamide |
| SMILES | Cc1nn(-c2cccc(C(=O)N(C)c3ccccc3)c2)c(C)c1Cl |
| InChI | InChI=1S/C19H18ClN3O/c1-13-18(20)14(2)23(21-13)17-11-7-8-15(12-17)19(24)22(3)16-9-5-4-6-10-16/h4-12H,1-3H3 |
| InChIKey | RITLACFLJGAYKA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |