C21H19Cl2N3O3 — CID 158120747
3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[4-(chloromethyl)-1,3-benzodioxol-5-yl]-N-methylbenzamide (PubChem CID 158120747) has the molecular formula C21H19Cl2N3O3 and a molecular weight of 432.31 g/mol. Its IUPAC name is 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[4-(chloromethyl)-1,3-benzodioxol-5-yl]-N-methylbenzamide.
| Compound Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[4-(chloromethyl)-1,3-benzodioxol-5-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 158120747 |
| Molecular Formula | C21H19Cl2N3O3 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[4-(chloromethyl)-1,3-benzodioxol-5-yl]-N-methylbenzamide |
| SMILES | Cc1nn(-c2cccc(C(=O)N(C)c3ccc4c(c3CCl)OCO4)c2)c(C)c1Cl |
| InChI | InChI=1S/C21H19Cl2N3O3/c1-12-19(23)13(2)26(24-12)15-6-4-5-14(9-15)21(27)25(3)17-7-8-18-20(16(17)10-22)29-11-28-18/h4-9H,10-11H2,1-3H3 |
| InChIKey | VSPPIBOOQFKTKZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|