C20H31NO — CID 142430314
ethanimine;1-ethyl-4-(4-methoxy-3-methylphenyl)bicyclo[2.2.2]octane (PubChem CID 142430314) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is ethanimine;1-ethyl-4-(4-methoxy-3-methylphenyl)bicyclo[2.2.2]octane.
| Compound Name | ethanimine;1-ethyl-4-(4-methoxy-3-methylphenyl)bicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 142430314 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | ethanimine;1-ethyl-4-(4-methoxy-3-methylphenyl)bicyclo[2.2.2]octane |
| SMILES | CCC12CCC(c3ccc(OC)c(C)c3)(CC1)CC2.[H]/N=C/C |
| InChI | InChI=1S/C18H26O.C2H5N/c1-4-17-7-10-18(11-8-17,12-9-17)15-5-6-16(19-3)14(2)13-15;1-2-3/h5-6,13H,4,7-12H2,1-3H3;2-3H,1H3/b;3-2+ |
| InChIKey | BPDLPXWWZFHAPA-ZPYUXNTASA-N |
| XLogP | 5.66 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|