C37H51N3 — CID 142430473
3-[(Z)-4-amino-3-methanimidoylbut-3-en-1-ynyl]-N-(1-cyclohexylethenyl)-N-[[4-(4-ethyl-3-methylphenyl)cyclohexyl]methyl]aniline;ethane (PubChem CID 142430473) has the molecular formula C37H51N3 and a molecular weight of 537.84 g/mol. Its IUPAC name is 3-[(Z)-4-amino-3-methanimidoylbut-3-en-1-ynyl]-N-(1-cyclohexylethenyl)-N-[[4-(4-ethyl-3-methylphenyl)cyclohexyl]methyl]aniline;ethane.
| Compound Name | 3-[(Z)-4-amino-3-methanimidoylbut-3-en-1-ynyl]-N-(1-cyclohexylethenyl)-N-[[4-(4-ethyl-3-methylphenyl)cyclohexyl]methyl]aniline;ethane |
|---|---|
| PubChem CID | 142430473 |
| Molecular Formula | C37H51N3 |
| Molecular Weight | 537.84 g/mol |
| Exact Mass | 537.41 |
| IUPAC Name | 3-[(Z)-4-amino-3-methanimidoylbut-3-en-1-ynyl]-N-(1-cyclohexylethenyl)-N-[[4-(4-ethyl-3-methylphenyl)cyclohexyl]methyl]aniline;ethane |
| SMILES | CC.[H]/N=C/C(C#Cc1cccc(N(CC2CCC(c3ccc(CC)c(C)c3)CC2)C(=C)C2CCCCC2)c1)=C\N |
| InChI | InChI=1S/C35H45N3.C2H6/c1-4-31-19-20-34(21-26(31)2)33-17-15-29(16-18-33)25-38(27(3)32-10-6-5-7-11-32)35-12-8-9-28(22-35)13-14-30(23-36)24-37;1-2/h8-9,12,19-24,29,32-33,36H,3-7,10-11,15-18,25,37H2,1-2H3;1-2H3/b30-24-,36-23+; |
| InChIKey | JZKWAZDQJZFETG-GSUJQRDMSA-N |
| XLogP | 9.30 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.84 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|