C17H22N2O2 — CID 142430525
N-(6-methoxyisoquinolin-1-yl)-N,3,3-trimethylbutanamide (PubChem CID 142430525) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-(6-methoxyisoquinolin-1-yl)-N,3,3-trimethylbutanamide.
| Compound Name | N-(6-methoxyisoquinolin-1-yl)-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 142430525 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-(6-methoxyisoquinolin-1-yl)-N,3,3-trimethylbutanamide |
| SMILES | COc1ccc2c(N(C)C(=O)CC(C)(C)C)nccc2c1 |
| InChI | InChI=1S/C17H22N2O2/c1-17(2,3)11-15(20)19(4)16-14-7-6-13(21-5)10-12(14)8-9-18-16/h6-10H,11H2,1-5H3 |
| InChIKey | AJTHVNJGHYQXTN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |