About 1-benzyl-3-[(5-ethyl-3-pyridinyl)methyl]urea;molecular hydrogen
1-benzyl-3-[(5-ethyl-3-pyridinyl)methyl]urea;molecular hydrogen (PubChem CID 142430760) has the molecular formula C16H23N3O
and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-benzyl-3-[(5-ethyl-3-pyridinyl)methyl]urea;molecular hydrogen.
Molecular Properties
| Compound Name | 1-benzyl-3-[(5-ethyl-3-pyridinyl)methyl]urea;molecular hydrogen |
| PubChem CID | 142430760 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 1-benzyl-3-[(5-ethyl-3-pyridinyl)methyl]urea;molecular hydrogen |
| SMILES | CCc1cncc(CNC(=O)NCc2ccccc2)c1.[H][H].[H][H] |
| InChI | InChI=1S/C16H19N3O.2H2/c1-2-13-8-15(10-17-9-13)12-19-16(20)18-11-14-6-4-3-5-7-14;;/h3-10H,2,11-12H2,1H3,(H2,18,19,20);2*1H |
| InChIKey | HVRFGUVSVKWXON-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-3-[(5-ethyl-3-pyridinyl)methyl]urea;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-[(5-ethyl-3-pyridinyl)methyl]urea;molecular hydrogen?
The IUPAC name of 1-benzyl-3-[(5-ethyl-3-pyridinyl)methyl]urea;molecular hydrogen (CID 142430760) is 1-benzyl-3-[(5-ethyl-3-pyridinyl)methyl]urea;molecular hydrogen.
What is the SMILES notation for 1-benzyl-3-[(5-ethyl-3-pyridinyl)methyl]urea;molecular hydrogen?
The canonical SMILES for 1-benzyl-3-[(5-ethyl-3-pyridinyl)methyl]urea;molecular hydrogen is CCc1cncc(CNC(=O)NCc2ccccc2)c1.[H][H].[H][H].
What is the InChIKey of 1-benzyl-3-[(5-ethyl-3-pyridinyl)methyl]urea;molecular hydrogen?
The InChIKey is HVRFGUVSVKWXON-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O.2H2/c1-2-13-8-15(10-17-9-13)12-19-16(20)18-11-14-6-4-3-5-7-14;;/h3-10H,2,11-12H2,1H3,(H2,18,19,20);2*1H.
What are the key properties of 1-benzyl-3-[(5-ethyl-3-pyridinyl)methyl]urea;molecular hydrogen?
1-benzyl-3-[(5-ethyl-3-pyridinyl)methyl]urea;molecular hydrogen has a molecular weight of 273.38 g/mol, XLogP of 3.14, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-[(5-ethyl-3-pyridinyl)methyl]urea;molecular hydrogen is sourced from PubChem (CID 142430760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).