C9H11NS — CID 142431391
4-imino-2-prop-1-en-2-ylcyclohexa-1,5-diene-1-thiol (PubChem CID 142431391) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 4-imino-2-prop-1-en-2-ylcyclohexa-1,5-diene-1-thiol.
| Compound Name | 4-imino-2-prop-1-en-2-ylcyclohexa-1,5-diene-1-thiol |
|---|---|
| PubChem CID | 142431391 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 4-imino-2-prop-1-en-2-ylcyclohexa-1,5-diene-1-thiol |
| SMILES | [H]/N=C1\C=CC(S)=C(C(=C)C)C1 |
| InChI | InChI=1S/C9H11NS/c1-6(2)8-5-7(10)3-4-9(8)11/h3-4,10-11H,1,5H2,2H3/b10-7+ |
| InChIKey | ZRXXEVMKGVZVRL-JXMROGBWSA-N |
| XLogP | 2.73 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|