C9H11N — CID 88993567
2,5-Dimethyl-6-methylidenecyclohexa-2,4-dien-1-imine (PubChem CID 88993567) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is 2,5-dimethyl-6-methylidenecyclohexa-2,4-dien-1-imine.
| Compound Name | 2,5-Dimethyl-6-methylidenecyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 88993567 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 2,5-dimethyl-6-methylidenecyclohexa-2,4-dien-1-imine |
| SMILES | CC1=CC=C(C(=N)C1=C)C |
| InChI | InChI=1S/C9H11N/c1-6-4-5-7(2)9(10)8(6)3/h4-5,10H,3H2,1-2H3 |
| InChIKey | ZPELNHGYYKPGKP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 23.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | 254 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|