C9H10N2 — CID 142434040
6-methyl-1H-pyrido[1,2-c]pyrimidine (PubChem CID 142434040) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 6-methyl-1H-pyrido[1,2-c]pyrimidine.
| Compound Name | 6-methyl-1H-pyrido[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 142434040 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 6-methyl-1H-pyrido[1,2-c]pyrimidine |
| SMILES | CC1=CC2=CC=NCN2C=C1 |
| InChI | InChI=1S/C9H10N2/c1-8-3-5-11-7-10-4-2-9(11)6-8/h2-6H,7H2,1H3 |
| InChIKey | RFAOEOJFGCPNIN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |