C19H22O — CID 142435994
2-[2-[7-(2-cyclopropylethyl)naphthalen-2-yl]ethyl]oxirane (PubChem CID 142435994) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-[2-[7-(2-cyclopropylethyl)naphthalen-2-yl]ethyl]oxirane.
| Compound Name | 2-[2-[7-(2-cyclopropylethyl)naphthalen-2-yl]ethyl]oxirane |
|---|---|
| PubChem CID | 142435994 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-[2-[7-(2-cyclopropylethyl)naphthalen-2-yl]ethyl]oxirane |
| SMILES | c1cc2ccc(CCC3CO3)cc2cc1CCC1CC1 |
| InChI | InChI=1S/C19H22O/c1-2-14(1)3-4-15-5-8-17-9-6-16(12-18(17)11-15)7-10-19-13-20-19/h5-6,8-9,11-12,14,19H,1-4,7,10,13H2 |
| InChIKey | FYEYYNFCAIONAE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|