C15H33N3O4 — CID 142436923
heptane;N-(2-hydroxyethyl)-2-[[2-(2-hydroxyethylamino)-2-oxoethyl]amino]acetamide (PubChem CID 142436923) has the molecular formula C15H33N3O4 and a molecular weight of 319.45 g/mol. Its IUPAC name is heptane;N-(2-hydroxyethyl)-2-[[2-(2-hydroxyethylamino)-2-oxoethyl]amino]acetamide.
| Compound Name | heptane;N-(2-hydroxyethyl)-2-[[2-(2-hydroxyethylamino)-2-oxoethyl]amino]acetamide |
|---|---|
| PubChem CID | 142436923 |
| Molecular Formula | C15H33N3O4 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | heptane;N-(2-hydroxyethyl)-2-[[2-(2-hydroxyethylamino)-2-oxoethyl]amino]acetamide |
| SMILES | CCCCCCC.O=C(CNCC(=O)NCCO)NCCO |
| InChI | InChI=1S/C8H17N3O4.C7H16/c12-3-1-10-7(14)5-9-6-8(15)11-2-4-13;1-3-5-7-6-4-2/h9,12-13H,1-6H2,(H,10,14)(H,11,15);3-7H2,1-2H3 |
| InChIKey | VJRLTVXUDJLWMD-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|