C9H12F3N — CID 142439236
prop-1-yne;(Z)-1,1,1-trifluoro-N-methylpent-3-en-2-imine (PubChem CID 142439236) has the molecular formula C9H12F3N and a molecular weight of 191.20 g/mol. Its IUPAC name is prop-1-yne;(Z)-1,1,1-trifluoro-N-methylpent-3-en-2-imine.
| Compound Name | prop-1-yne;(Z)-1,1,1-trifluoro-N-methylpent-3-en-2-imine |
|---|---|
| PubChem CID | 142439236 |
| Molecular Formula | C9H12F3N |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | prop-1-yne;(Z)-1,1,1-trifluoro-N-methylpent-3-en-2-imine |
| SMILES | C#CC.C/C=C\C(=N/C)C(F)(F)F |
| InChI | InChI=1S/C6H8F3N.C3H4/c1-3-4-5(10-2)6(7,8)9;1-3-2/h3-4H,1-2H3;1H,2H3/b4-3-,10-5+; |
| InChIKey | HSIHWZRXQVGZFD-HGMYAUDCSA-N |
| XLogP | 2.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|