C20H34FNO6 — CID 142441422
methyl 2-[4-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]cyclohexyl]-2-fluoroacetate (PubChem CID 142441422) has the molecular formula C20H34FNO6 and a molecular weight of 403.49 g/mol. Its IUPAC name is methyl 2-[4-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]cyclohexyl]-2-fluoroacetate.
| Compound Name | methyl 2-[4-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]cyclohexyl]-2-fluoroacetate |
|---|---|
| PubChem CID | 142441422 |
| Molecular Formula | C20H34FNO6 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | methyl 2-[4-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]cyclohexyl]-2-fluoroacetate |
| SMILES | COC(=O)C(F)C1CCC(CN(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H34FNO6/c1-19(2,3)27-17(24)22(18(25)28-20(4,5)6)12-13-8-10-14(11-9-13)15(21)16(23)26-7/h13-15H,8-12H2,1-7H3 |
| InChIKey | ZRVPRCQEIXDPKW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|