C16H29NO5 — CID 142441432
methyl 2-[4-[2-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]cyclohexyl]acetate (PubChem CID 142441432) has the molecular formula C16H29NO5 and a molecular weight of 315.41 g/mol. Its IUPAC name is methyl 2-[4-[2-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]cyclohexyl]acetate.
| Compound Name | methyl 2-[4-[2-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 142441432 |
| Molecular Formula | C16H29NO5 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | methyl 2-[4-[2-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]cyclohexyl]acetate |
| SMILES | COC(=O)CC1CCC(C(CO)NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H29NO5/c1-16(2,3)22-15(20)17-13(10-18)12-7-5-11(6-8-12)9-14(19)21-4/h11-13,18H,5-10H2,1-4H3,(H,17,20) |
| InChIKey | WFHPTECPILQSBG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |