C14H26O4 — CID 157377003
tert-butyl 2-[4-(1,2-dihydroxyethyl)cyclohexyl]acetate (PubChem CID 157377003) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is tert-butyl 2-[4-(1,2-dihydroxyethyl)cyclohexyl]acetate.
| Compound Name | tert-butyl 2-[4-(1,2-dihydroxyethyl)cyclohexyl]acetate |
|---|---|
| PubChem CID | 157377003 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | tert-butyl 2-[4-(1,2-dihydroxyethyl)cyclohexyl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CCC(C(O)CO)CC1 |
| InChI | InChI=1S/C14H26O4/c1-14(2,3)18-13(17)8-10-4-6-11(7-5-10)12(16)9-15/h10-12,15-16H,4-9H2,1-3H3 |
| InChIKey | JGDDHTPEPJIKGJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |