C17H29NO5 — CID 164726182
tert-butyl (5R)-5-cyclopropyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopentanoate (PubChem CID 164726182) has the molecular formula C17H29NO5 and a molecular weight of 327.42 g/mol. Its IUPAC name is tert-butyl (5R)-5-cyclopropyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopentanoate.
| Compound Name | tert-butyl (5R)-5-cyclopropyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopentanoate |
|---|---|
| PubChem CID | 164726182 |
| Molecular Formula | C17H29NO5 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | tert-butyl (5R)-5-cyclopropyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)CC(=O)C[C@@H](NC(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C17H29NO5/c1-16(2,3)22-14(20)10-12(19)9-13(11-7-8-11)18-15(21)23-17(4,5)6/h11,13H,7-10H2,1-6H3,(H,18,21)/t13-/m1/s1 |
| InChIKey | MZKKMHWFTFLIKU-CYBMUJFWSA-N |
| XLogP | 2.98 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|