C32H38N11O3Si — CID 142442011
CID 142442011 (PubChem CID 142442011) has the molecular formula C32H38N11O3Si and a molecular weight of 652.82 g/mol.
| Compound Name | CID 142442011 |
|---|---|
| PubChem CID | 142442011 |
| Molecular Formula | C32H38N11O3Si |
| Molecular Weight | 652.82 g/mol |
| Exact Mass | 652.29 |
| IUPAC Name | — |
| SMILES | COc1cc(N2CCC(N3CCN(C(C)=O)CC3)CC2)ccc1Nc1ncc(-c2ccc(C#N)c(O[Si](C)Cn3cnnn3)c2)cn1 |
| InChI | InChI=1S/C32H38N11O3Si/c1-23(44)40-12-14-42(15-13-40)27-8-10-41(11-9-27)28-6-7-29(31(17-28)45-2)37-32-34-19-26(20-35-32)24-4-5-25(18-33)30(16-24)46-47(3)22-43-21-36-38-39-43/h4-7,16-17,19-21,27H,8-15,22H2,1-3H3,(H,34,35,37) |
| InChIKey | VGXPMNRQOJIJIP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 150.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.82 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|