C34H45ClN2O4S — CID 142445002
(8E)-22-(4-chloro-2-propylphenyl)-7-(2-hydroxyethyl)-11,12-dimethyl-13-oxo-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraen-15-one (PubChem CID 142445002) has the molecular formula C34H45ClN2O4S and a molecular weight of 613.26 g/mol. Its IUPAC name is (8E)-22-(4-chloro-2-propylphenyl)-7-(2-hydroxyethyl)-11,12-dimethyl-13-oxo-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraen-15-one.
| Compound Name | (8E)-22-(4-chloro-2-propylphenyl)-7-(2-hydroxyethyl)-11,12-dimethyl-13-oxo-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraen-15-one |
|---|---|
| PubChem CID | 142445002 |
| Molecular Formula | C34H45ClN2O4S |
| Molecular Weight | 613.26 g/mol |
| Exact Mass | 612.28 |
| IUPAC Name | (8E)-22-(4-chloro-2-propylphenyl)-7-(2-hydroxyethyl)-11,12-dimethyl-13-oxo-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraen-15-one |
| SMILES | CCCc1cc(Cl)ccc1C1COc2ccc3cc2N(C1)CC1CCC1C(CCO)/C=C/CC(C)C(C)S(=O)NC3=O |
| InChI | InChI=1S/C34H45ClN2O4S/c1-4-6-25-17-29(35)11-13-31(25)28-20-37-19-27-9-12-30(27)24(15-16-38)8-5-7-22(2)23(3)42(40)36-34(39)26-10-14-33(41-21-28)32(37)18-26/h5,8,10-11,13-14,17-18,22-24,27-28,30,38H,4,6-7,9,12,15-16,19-21H2,1-3H3,(H,36,39)/b8-5+ |
| InChIKey | CVEUCSVVOUTKOL-VMPITWQZSA-N |
| XLogP | 6.68 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.26 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|