C35H47ClN2O5S — CID 142444893
(8E)-22-(4-chloro-2-propylphenyl)-7-(2-methoxyethoxy)-11,12-dimethyl-13-oxo-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraen-15-one (PubChem CID 142444893) has the molecular formula C35H47ClN2O5S and a molecular weight of 643.29 g/mol. Its IUPAC name is (8E)-22-(4-chloro-2-propylphenyl)-7-(2-methoxyethoxy)-11,12-dimethyl-13-oxo-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraen-15-one.
| Compound Name | (8E)-22-(4-chloro-2-propylphenyl)-7-(2-methoxyethoxy)-11,12-dimethyl-13-oxo-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraen-15-one |
|---|---|
| PubChem CID | 142444893 |
| Molecular Formula | C35H47ClN2O5S |
| Molecular Weight | 643.29 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | (8E)-22-(4-chloro-2-propylphenyl)-7-(2-methoxyethoxy)-11,12-dimethyl-13-oxo-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraen-15-one |
| SMILES | CCCc1cc(Cl)ccc1C1COc2ccc3cc2N(C1)CC1CCC1C(OCCOC)/C=C/CC(C)C(C)S(=O)NC3=O |
| InChI | InChI=1S/C35H47ClN2O5S/c1-5-7-25-18-29(36)12-14-30(25)28-21-38-20-27-10-13-31(27)33(42-17-16-41-4)9-6-8-23(2)24(3)44(40)37-35(39)26-11-15-34(43-22-28)32(38)19-26/h6,9,11-12,14-15,18-19,23-24,27-28,31,33H,5,7-8,10,13,16-17,20-22H2,1-4H3,(H,37,39)/b9-6+ |
| InChIKey | OXSCRYHDIKBGSC-RMKNXTFCSA-N |
| XLogP | 6.71 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.29 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|