C33H43ClN2O4S — CID 145026140
(8E)-22-(4-chloro-2-propylphenyl)-7-(2-methoxyethoxy)-20-oxa-13-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraen-15-one (PubChem CID 145026140) has the molecular formula C33H43ClN2O4S and a molecular weight of 599.24 g/mol. Its IUPAC name is (8E)-22-(4-chloro-2-propylphenyl)-7-(2-methoxyethoxy)-20-oxa-13-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraen-15-one.
| Compound Name | (8E)-22-(4-chloro-2-propylphenyl)-7-(2-methoxyethoxy)-20-oxa-13-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraen-15-one |
|---|---|
| PubChem CID | 145026140 |
| Molecular Formula | C33H43ClN2O4S |
| Molecular Weight | 599.24 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | (8E)-22-(4-chloro-2-propylphenyl)-7-(2-methoxyethoxy)-20-oxa-13-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraen-15-one |
| SMILES | CCCc1cc(Cl)ccc1C1COc2ccc3cc2N(C1)CC1CCC1C(OCCOC)/C=C/CCCSNC3=O |
| InChI | InChI=1S/C33H43ClN2O4S/c1-3-7-23-18-27(34)11-13-28(23)26-21-36-20-25-9-12-29(25)31(39-16-15-38-2)8-5-4-6-17-41-35-33(37)24-10-14-32(40-22-26)30(36)19-24/h5,8,10-11,13-14,18-19,25-26,29,31H,3-4,6-7,9,12,15-17,20-22H2,1-2H3,(H,35,37)/b8-5+ |
| InChIKey | ZITYVGVWQRZVQB-VMPITWQZSA-N |
| XLogP | 7.06 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.24 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|