C39H56ClN3O5S — CID 142532632
22-(4-chloro-2-propylphenyl)-7-(1,3-dioxan-2-yl)-11-hydroxy-12-methyl-20-oxa-13-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-16(25),17,19(24)-trien-15-one;pyrrolidine (PubChem CID 142532632) has the molecular formula C39H56ClN3O5S and a molecular weight of 714.41 g/mol. Its IUPAC name is 22-(4-chloro-2-propylphenyl)-7-(1,3-dioxan-2-yl)-11-hydroxy-12-methyl-20-oxa-13-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-16(25),17,19(24)-trien-15-one;pyrrolidine.
| Compound Name | 22-(4-chloro-2-propylphenyl)-7-(1,3-dioxan-2-yl)-11-hydroxy-12-methyl-20-oxa-13-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-16(25),17,19(24)-trien-15-one;pyrrolidine |
|---|---|
| PubChem CID | 142532632 |
| Molecular Formula | C39H56ClN3O5S |
| Molecular Weight | 714.41 g/mol |
| Exact Mass | 713.36 |
| IUPAC Name | 22-(4-chloro-2-propylphenyl)-7-(1,3-dioxan-2-yl)-11-hydroxy-12-methyl-20-oxa-13-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-16(25),17,19(24)-trien-15-one;pyrrolidine |
| SMILES | C1CCNC1.CCCc1cc(Cl)ccc1C1COc2ccc3cc2N(C1)CC1CCC1C(C1OCCCO1)CCCC(O)C(C)SNC3=O |
| InChI | InChI=1S/C35H47ClN2O5S.C4H9N/c1-3-6-23-17-27(36)11-13-28(23)26-20-38-19-25-9-12-29(25)30(35-41-15-5-16-42-35)7-4-8-32(39)22(2)44-37-34(40)24-10-14-33(43-21-26)31(38)18-24;1-2-4-5-3-1/h10-11,13-14,17-18,22,25-26,29-30,32,35,39H,3-9,12,15-16,19-21H2,1-2H3,(H,37,40);5H,1-4H2 |
| InChIKey | WHOZZRFDYPTEPA-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.41 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|