C24H36FN3O2 — CID 142446718
N-[2-[cyano-(3-fluorophenyl)-piperidin-4-ylmethyl]cyclopentyl]formamide;2-methoxy-2-methylpropane (PubChem CID 142446718) has the molecular formula C24H36FN3O2 and a molecular weight of 417.57 g/mol. Its IUPAC name is N-[2-[cyano-(3-fluorophenyl)-piperidin-4-ylmethyl]cyclopentyl]formamide;2-methoxy-2-methylpropane.
| Compound Name | N-[2-[cyano-(3-fluorophenyl)-piperidin-4-ylmethyl]cyclopentyl]formamide;2-methoxy-2-methylpropane |
|---|---|
| PubChem CID | 142446718 |
| Molecular Formula | C24H36FN3O2 |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | N-[2-[cyano-(3-fluorophenyl)-piperidin-4-ylmethyl]cyclopentyl]formamide;2-methoxy-2-methylpropane |
| SMILES | COC(C)(C)C.N#CC(c1cccc(F)c1)(C1CCNCC1)C1CCCC1NC=O |
| InChI | InChI=1S/C19H24FN3O.C5H12O/c20-16-4-1-3-15(11-16)19(12-21,14-7-9-22-10-8-14)17-5-2-6-18(17)23-13-24;1-5(2,3)6-4/h1,3-4,11,13-14,17-18,22H,2,5-10H2,(H,23,24);1-4H3 |
| InChIKey | CFDBZAHXBMYLNU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|