C21H29FN4 — CID 156886845
(1S)-2-[(3-fluorophenyl)-(2-methylimidazol-1-yl)-piperidin-4-ylmethyl]cyclopentan-1-amine (PubChem CID 156886845) has the molecular formula C21H29FN4 and a molecular weight of 356.49 g/mol. Its IUPAC name is (1S)-2-[(3-fluorophenyl)-(2-methylimidazol-1-yl)-piperidin-4-ylmethyl]cyclopentan-1-amine.
| Compound Name | (1S)-2-[(3-fluorophenyl)-(2-methylimidazol-1-yl)-piperidin-4-ylmethyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 156886845 |
| Molecular Formula | C21H29FN4 |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (1S)-2-[(3-fluorophenyl)-(2-methylimidazol-1-yl)-piperidin-4-ylmethyl]cyclopentan-1-amine |
| SMILES | Cc1nccn1C(c1cccc(F)c1)(C1CCNCC1)C1CCC[C@@H]1N |
| InChI | InChI=1S/C21H29FN4/c1-15-25-12-13-26(15)21(16-8-10-24-11-9-16,19-6-3-7-20(19)23)17-4-2-5-18(22)14-17/h2,4-5,12-14,16,19-20,24H,3,6-11,23H2,1H3/t19?,20-,21?/m0/s1 |
| InChIKey | OYRPWCKTQZRRFP-KBWCOIMZSA-N |
| XLogP | 3.20 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |