C25H30N4OS — CID 142447084
N-isoquinolin-6-ylcyclopropanecarboxamide;N-phenylsulfanyl-1-piperidin-4-ylmethanamine (PubChem CID 142447084) has the molecular formula C25H30N4OS and a molecular weight of 434.61 g/mol. Its IUPAC name is N-isoquinolin-6-ylcyclopropanecarboxamide;N-phenylsulfanyl-1-piperidin-4-ylmethanamine.
| Compound Name | N-isoquinolin-6-ylcyclopropanecarboxamide;N-phenylsulfanyl-1-piperidin-4-ylmethanamine |
|---|---|
| PubChem CID | 142447084 |
| Molecular Formula | C25H30N4OS |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | N-isoquinolin-6-ylcyclopropanecarboxamide;N-phenylsulfanyl-1-piperidin-4-ylmethanamine |
| SMILES | O=C(Nc1ccc2cnccc2c1)C1CC1.c1ccc(SNCC2CCNCC2)cc1 |
| InChI | InChI=1S/C13H12N2O.C12H18N2S/c16-13(9-1-2-9)15-12-4-3-11-8-14-6-5-10(11)7-12;1-2-4-12(5-3-1)15-14-10-11-6-8-13-9-7-11/h3-9H,1-2H2,(H,15,16);1-5,11,13-14H,6-10H2 |
| InChIKey | XOFGWPZOYOPXAM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|