C20H19N3O — CID 172895311
(2S,3S)-N-isoquinolin-7-yl-2-phenylpyrrolidine-3-carboxamide (PubChem CID 172895311) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is (2S,3S)-N-isoquinolin-7-yl-2-phenylpyrrolidine-3-carboxamide.
| Compound Name | (2S,3S)-N-isoquinolin-7-yl-2-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 172895311 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (2S,3S)-N-isoquinolin-7-yl-2-phenylpyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc2ccncc2c1)[C@H]1CCN[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H19N3O/c24-20(18-9-11-22-19(18)15-4-2-1-3-5-15)23-17-7-6-14-8-10-21-13-16(14)12-17/h1-8,10,12-13,18-19,22H,9,11H2,(H,23,24)/t18-,19+/m0/s1 |
| InChIKey | KXSICKNMVICRLQ-RBUKOAKNSA-N |
| XLogP | 3.52 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |