C25H25N7O — CID 142447426
N-[8-amino-6-[2-(cyanomethyl)-6-methylphenyl]-2,7-naphthyridin-3-yl]formamide;4-cyclopropyl-1-methylpyrazole (PubChem CID 142447426) has the molecular formula C25H25N7O and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[8-amino-6-[2-(cyanomethyl)-6-methylphenyl]-2,7-naphthyridin-3-yl]formamide;4-cyclopropyl-1-methylpyrazole.
| Compound Name | N-[8-amino-6-[2-(cyanomethyl)-6-methylphenyl]-2,7-naphthyridin-3-yl]formamide;4-cyclopropyl-1-methylpyrazole |
|---|---|
| PubChem CID | 142447426 |
| Molecular Formula | C25H25N7O |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-[8-amino-6-[2-(cyanomethyl)-6-methylphenyl]-2,7-naphthyridin-3-yl]formamide;4-cyclopropyl-1-methylpyrazole |
| SMILES | Cc1cccc(CC#N)c1-c1cc2cc(NC=O)ncc2c(N)n1.Cn1cc(C2CC2)cn1 |
| InChI | InChI=1S/C18H15N5O.C7H10N2/c1-11-3-2-4-12(5-6-19)17(11)15-7-13-8-16(22-10-24)21-9-14(13)18(20)23-15;1-9-5-7(4-8-9)6-2-3-6/h2-4,7-10H,5H2,1H3,(H2,20,23)(H,21,22,24);4-6H,2-3H2,1H3 |
| InChIKey | XBNYECKCFCBIMQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|