C19H22N6O — CID 142447705
N-[8-amino-6-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-3-yl]formamide;cyclopropane (PubChem CID 142447705) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is N-[8-amino-6-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-3-yl]formamide;cyclopropane.
| Compound Name | N-[8-amino-6-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-3-yl]formamide;cyclopropane |
|---|---|
| PubChem CID | 142447705 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | N-[8-amino-6-[4-methyl-5-(methylamino)-3-pyridinyl]-2,7-naphthyridin-3-yl]formamide;cyclopropane |
| SMILES | C1CC1.CNc1cncc(-c2cc3cc(NC=O)ncc3c(N)n2)c1C |
| InChI | InChI=1S/C16H16N6O.C3H6/c1-9-11(5-19-7-14(9)18-2)13-3-10-4-15(21-8-23)20-6-12(10)16(17)22-13;1-2-3-1/h3-8,18H,1-2H3,(H2,17,22)(H,20,21,23);1-3H2 |
| InChIKey | RRRUVOFMIMAPIZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|