C19H19N5O — CID 142447326
N-[8-amino-6-(3-amino-2-methylphenyl)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide (PubChem CID 142447326) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is N-[8-amino-6-(3-amino-2-methylphenyl)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[8-amino-6-(3-amino-2-methylphenyl)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 142447326 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | N-[8-amino-6-(3-amino-2-methylphenyl)-2,7-naphthyridin-3-yl]cyclopropanecarboxamide |
| SMILES | Cc1c(N)cccc1-c1cc2cc(NC(=O)C3CC3)ncc2c(N)n1 |
| InChI | InChI=1S/C19H19N5O/c1-10-13(3-2-4-15(10)20)16-7-12-8-17(24-19(25)11-5-6-11)22-9-14(12)18(21)23-16/h2-4,7-9,11H,5-6,20H2,1H3,(H2,21,23)(H,22,24,25) |
| InChIKey | ZIOAIRGELXSOHF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|