C20H21N5O3 — CID 157241389
(3-methyloxetan-3-yl) N-[8-amino-6-(3-amino-2-methylphenyl)-2,7-naphthyridin-3-yl]carbamate (PubChem CID 157241389) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is (3-methyloxetan-3-yl) N-[8-amino-6-(3-amino-2-methylphenyl)-2,7-naphthyridin-3-yl]carbamate.
| Compound Name | (3-methyloxetan-3-yl) N-[8-amino-6-(3-amino-2-methylphenyl)-2,7-naphthyridin-3-yl]carbamate |
|---|---|
| PubChem CID | 157241389 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (3-methyloxetan-3-yl) N-[8-amino-6-(3-amino-2-methylphenyl)-2,7-naphthyridin-3-yl]carbamate |
| SMILES | Cc1c(N)cccc1-c1cc2cc(NC(=O)OC3(C)COC3)ncc2c(N)n1 |
| InChI | InChI=1S/C20H21N5O3/c1-11-13(4-3-5-15(11)21)16-6-12-7-17(23-8-14(12)18(22)24-16)25-19(26)28-20(2)9-27-10-20/h3-8H,9-10,21H2,1-2H3,(H2,22,24)(H,23,25,26) |
| InChIKey | MHQGMUJEDVKLLQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|