C21H22FN5O3 — CID 140921613
(3-methyloxolan-3-yl) N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate (PubChem CID 140921613) has the molecular formula C21H22FN5O3 and a molecular weight of 411.44 g/mol. Its IUPAC name is (3-methyloxolan-3-yl) N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate.
| Compound Name | (3-methyloxolan-3-yl) N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate |
|---|---|
| PubChem CID | 140921613 |
| Molecular Formula | C21H22FN5O3 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (3-methyloxolan-3-yl) N-[8-amino-6-(5-amino-4-methyl-3-pyridinyl)-7-fluoroisoquinolin-3-yl]carbamate |
| SMILES | Cc1c(N)cncc1-c1cc2cc(NC(=O)OC3(C)CCOC3)ncc2c(N)c1F |
| InChI | InChI=1S/C21H22FN5O3/c1-11-14(7-25-9-16(11)23)13-5-12-6-17(26-8-15(12)19(24)18(13)22)27-20(28)30-21(2)3-4-29-10-21/h5-9H,3-4,10,23-24H2,1-2H3,(H,26,27,28) |
| InChIKey | JGWNIEWXFUSUNG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|