C20H21N5O4S — CID 158743870
[(3S)-1,1-dioxothiolan-3-yl] N-[8-amino-6-(3-amino-2-methylphenyl)-2,7-naphthyridin-3-yl]carbamate (PubChem CID 158743870) has the molecular formula C20H21N5O4S and a molecular weight of 427.49 g/mol. Its IUPAC name is [(3S)-1,1-dioxothiolan-3-yl] N-[8-amino-6-(3-amino-2-methylphenyl)-2,7-naphthyridin-3-yl]carbamate.
| Compound Name | [(3S)-1,1-dioxothiolan-3-yl] N-[8-amino-6-(3-amino-2-methylphenyl)-2,7-naphthyridin-3-yl]carbamate |
|---|---|
| PubChem CID | 158743870 |
| Molecular Formula | C20H21N5O4S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | [(3S)-1,1-dioxothiolan-3-yl] N-[8-amino-6-(3-amino-2-methylphenyl)-2,7-naphthyridin-3-yl]carbamate |
| SMILES | Cc1c(N)cccc1-c1cc2cc(NC(=O)O[C@H]3CCS(=O)(=O)C3)ncc2c(N)n1 |
| InChI | InChI=1S/C20H21N5O4S/c1-11-14(3-2-4-16(11)21)17-7-12-8-18(23-9-15(12)19(22)24-17)25-20(26)29-13-5-6-30(27,28)10-13/h2-4,7-9,13H,5-6,10,21H2,1H3,(H2,22,24)(H,23,25,26)/t13-/m0/s1 |
| InChIKey | WNNGNKOPXKQAGY-ZDUSSCGKSA-N |
| XLogP | 2.51 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|