C27H29N7O — CID 142449533
4-[4-[4-(2-cyanopropan-2-yl)piperidin-1-yl]anilino]-6-methanimidoyl-2-phenylpyrimidine-5-carboxamide (PubChem CID 142449533) has the molecular formula C27H29N7O and a molecular weight of 467.58 g/mol. Its IUPAC name is 4-[4-[4-(2-cyanopropan-2-yl)piperidin-1-yl]anilino]-6-methanimidoyl-2-phenylpyrimidine-5-carboxamide.
| Compound Name | 4-[4-[4-(2-cyanopropan-2-yl)piperidin-1-yl]anilino]-6-methanimidoyl-2-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 142449533 |
| Molecular Formula | C27H29N7O |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 4-[4-[4-(2-cyanopropan-2-yl)piperidin-1-yl]anilino]-6-methanimidoyl-2-phenylpyrimidine-5-carboxamide |
| SMILES | [H]/N=C/c1nc(-c2ccccc2)nc(Nc2ccc(N3CCC(C(C)(C)C#N)CC3)cc2)c1C(N)=O |
| InChI | InChI=1S/C27H29N7O/c1-27(2,17-29)19-12-14-34(15-13-19)21-10-8-20(9-11-21)31-26-23(24(30)35)22(16-28)32-25(33-26)18-6-4-3-5-7-18/h3-11,16,19,28H,12-15H2,1-2H3,(H2,30,35)(H,31,32,33)/b28-16+ |
| InChIKey | ILTIVVARJOGGEC-LQKURTRISA-N |
| XLogP | 4.75 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|