C20H37NO2 — CID 142450342
ethane;1-methoxy-3-(propan-2-ylamino)propan-2-ol;6-methylidene-7-prop-2-enylcyclohepta-1,4-diene (PubChem CID 142450342) has the molecular formula C20H37NO2 and a molecular weight of 323.52 g/mol. Its IUPAC name is ethane;1-methoxy-3-(propan-2-ylamino)propan-2-ol;6-methylidene-7-prop-2-enylcyclohepta-1,4-diene.
| Compound Name | ethane;1-methoxy-3-(propan-2-ylamino)propan-2-ol;6-methylidene-7-prop-2-enylcyclohepta-1,4-diene |
|---|---|
| PubChem CID | 142450342 |
| Molecular Formula | C20H37NO2 |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.28 |
| IUPAC Name | ethane;1-methoxy-3-(propan-2-ylamino)propan-2-ol;6-methylidene-7-prop-2-enylcyclohepta-1,4-diene |
| SMILES | C=CCC1C=CCC=CC1=C.CC.COCC(O)CNC(C)C |
| InChI | InChI=1S/C11H14.C7H17NO2.C2H6/c1-3-7-11-9-6-4-5-8-10(11)2;1-6(2)8-4-7(9)5-10-3;1-2/h3,5-6,8-9,11H,1-2,4,7H2;6-9H,4-5H2,1-3H3;1-2H3 |
| InChIKey | ARSOCPTXXOWPNV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|