C32H31F2NO2S2 — CID 142450838
2-[3-[4-[[[3-(difluoromethyl)phenyl]methyl-(2,4,6-trimethylphenyl)sulfanylamino]methyl]phenyl]phenyl]sulfanylacetic acid (PubChem CID 142450838) has the molecular formula C32H31F2NO2S2 and a molecular weight of 563.74 g/mol. Its IUPAC name is 2-[3-[4-[[[3-(difluoromethyl)phenyl]methyl-(2,4,6-trimethylphenyl)sulfanylamino]methyl]phenyl]phenyl]sulfanylacetic acid.
| Compound Name | 2-[3-[4-[[[3-(difluoromethyl)phenyl]methyl-(2,4,6-trimethylphenyl)sulfanylamino]methyl]phenyl]phenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 142450838 |
| Molecular Formula | C32H31F2NO2S2 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | 2-[3-[4-[[[3-(difluoromethyl)phenyl]methyl-(2,4,6-trimethylphenyl)sulfanylamino]methyl]phenyl]phenyl]sulfanylacetic acid |
| SMILES | Cc1cc(C)c(SN(Cc2ccc(-c3cccc(SCC(=O)O)c3)cc2)Cc2cccc(C(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C32H31F2NO2S2/c1-21-14-22(2)31(23(3)15-21)39-35(19-25-6-4-8-28(16-25)32(33)34)18-24-10-12-26(13-11-24)27-7-5-9-29(17-27)38-20-30(36)37/h4-17,32H,18-20H2,1-3H3,(H,36,37) |
| InChIKey | UEVJNKNMNIOHKF-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|