C24H21F3N2OS — CID 142450961
1-(4-methylphenyl)-N-(7-methylquinolin-8-yl)sulfanyl-N-[[5-(trifluoromethyl)furan-2-yl]methyl]methanamine (PubChem CID 142450961) has the molecular formula C24H21F3N2OS and a molecular weight of 442.51 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-(7-methylquinolin-8-yl)sulfanyl-N-[[5-(trifluoromethyl)furan-2-yl]methyl]methanamine.
| Compound Name | 1-(4-methylphenyl)-N-(7-methylquinolin-8-yl)sulfanyl-N-[[5-(trifluoromethyl)furan-2-yl]methyl]methanamine |
|---|---|
| PubChem CID | 142450961 |
| Molecular Formula | C24H21F3N2OS |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 1-(4-methylphenyl)-N-(7-methylquinolin-8-yl)sulfanyl-N-[[5-(trifluoromethyl)furan-2-yl]methyl]methanamine |
| SMILES | Cc1ccc(CN(Cc2ccc(C(F)(F)F)o2)Sc2c(C)ccc3cccnc23)cc1 |
| InChI | InChI=1S/C24H21F3N2OS/c1-16-5-8-18(9-6-16)14-29(15-20-11-12-21(30-20)24(25,26)27)31-23-17(2)7-10-19-4-3-13-28-22(19)23/h3-13H,14-15H2,1-2H3 |
| InChIKey | PQUXYKJRZUEJAJ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|