C24H28N2 — CID 142453469
ethane;1-methyl-2-[4-[(2E,5E)-octa-2,5,7-trien-2-yl]phenyl]benzimidazole (PubChem CID 142453469) has the molecular formula C24H28N2 and a molecular weight of 344.50 g/mol. Its IUPAC name is ethane;1-methyl-2-[4-[(2E,5E)-octa-2,5,7-trien-2-yl]phenyl]benzimidazole.
| Compound Name | ethane;1-methyl-2-[4-[(2E,5E)-octa-2,5,7-trien-2-yl]phenyl]benzimidazole |
|---|---|
| PubChem CID | 142453469 |
| Molecular Formula | C24H28N2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | ethane;1-methyl-2-[4-[(2E,5E)-octa-2,5,7-trien-2-yl]phenyl]benzimidazole |
| SMILES | C=C/C=C/C/C=C(\C)c1ccc(-c2nc3ccccc3n2C)cc1.CC |
| InChI | InChI=1S/C22H22N2.C2H6/c1-4-5-6-7-10-17(2)18-13-15-19(16-14-18)22-23-20-11-8-9-12-21(20)24(22)3;1-2/h4-6,8-16H,1,7H2,2-3H3;1-2H3/b6-5+,17-10+; |
| InChIKey | IQMYDONZZBIKSY-AEDBIYSYSA-N |
| XLogP | 6.80 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|