C23H29ClN4O4S — CID 142455047
(2S)-3-(6-chloro-1,3-benzothiazol-2-yl)-N-[1-(oxan-4-yl)-2-(prop-2-enoylamino)ethyl]-2-(propanoylamino)propanamide (PubChem CID 142455047) has the molecular formula C23H29ClN4O4S and a molecular weight of 493.03 g/mol. Its IUPAC name is (2S)-3-(6-chloro-1,3-benzothiazol-2-yl)-N-[1-(oxan-4-yl)-2-(prop-2-enoylamino)ethyl]-2-(propanoylamino)propanamide.
| Compound Name | (2S)-3-(6-chloro-1,3-benzothiazol-2-yl)-N-[1-(oxan-4-yl)-2-(prop-2-enoylamino)ethyl]-2-(propanoylamino)propanamide |
|---|---|
| PubChem CID | 142455047 |
| Molecular Formula | C23H29ClN4O4S |
| Molecular Weight | 493.03 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | (2S)-3-(6-chloro-1,3-benzothiazol-2-yl)-N-[1-(oxan-4-yl)-2-(prop-2-enoylamino)ethyl]-2-(propanoylamino)propanamide |
| SMILES | C=CC(=O)NCC(NC(=O)[C@H](Cc1nc2ccc(Cl)cc2s1)NC(=O)CC)C1CCOCC1 |
| InChI | InChI=1S/C23H29ClN4O4S/c1-3-20(29)25-13-18(14-7-9-32-10-8-14)28-23(31)17(26-21(30)4-2)12-22-27-16-6-5-15(24)11-19(16)33-22/h3,5-6,11,14,17-18H,1,4,7-10,12-13H2,2H3,(H,25,29)(H,26,30)(H,28,31)/t17-,18?/m0/s1 |
| InChIKey | NLKOADVANGDABZ-ZENAZSQFSA-N |
| XLogP | 2.60 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.03 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|