C27H38N4O3S — CID 135350738
N-[1-cyclohexyl-2-(prop-2-enoylamino)ethyl]-2-(propanoylamino)-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide (PubChem CID 135350738) has the molecular formula C27H38N4O3S and a molecular weight of 498.69 g/mol. Its IUPAC name is N-[1-cyclohexyl-2-(prop-2-enoylamino)ethyl]-2-(propanoylamino)-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | N-[1-cyclohexyl-2-(prop-2-enoylamino)ethyl]-2-(propanoylamino)-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 135350738 |
| Molecular Formula | C27H38N4O3S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | N-[1-cyclohexyl-2-(prop-2-enoylamino)ethyl]-2-(propanoylamino)-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide |
| SMILES | C=CC(=O)NCC(NC(=O)C(Cc1nc2ccc(C(C)C)cc2s1)NC(=O)CC)C1CCCCC1 |
| InChI | InChI=1S/C27H38N4O3S/c1-5-24(32)28-16-22(18-10-8-7-9-11-18)31-27(34)21(29-25(33)6-2)15-26-30-20-13-12-19(17(3)4)14-23(20)35-26/h5,12-14,17-18,21-22H,1,6-11,15-16H2,2-4H3,(H,28,32)(H,29,33)(H,31,34) |
| InChIKey | PQQJLERXFDDBSW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|