C29H39N5O3S — CID 147408222
N-[(2S)-2-[[(2S)-2-(butanoylamino)-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanoyl]amino]-2-cyclohexylethyl]-2-cyanoprop-2-enamide (PubChem CID 147408222) has the molecular formula C29H39N5O3S and a molecular weight of 537.73 g/mol. Its IUPAC name is N-[(2S)-2-[[(2S)-2-(butanoylamino)-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanoyl]amino]-2-cyclohexylethyl]-2-cyanoprop-2-enamide.
| Compound Name | N-[(2S)-2-[[(2S)-2-(butanoylamino)-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanoyl]amino]-2-cyclohexylethyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 147408222 |
| Molecular Formula | C29H39N5O3S |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | N-[(2S)-2-[[(2S)-2-(butanoylamino)-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanoyl]amino]-2-cyclohexylethyl]-2-cyanoprop-2-enamide |
| SMILES | C=C(C#N)C(=O)NC[C@@H](NC(=O)[C@H](Cc1nc2ccc(C(C)C)cc2s1)NC(=O)CCC)C1CCCCC1 |
| InChI | InChI=1S/C29H39N5O3S/c1-5-9-26(35)32-23(15-27-33-22-13-12-21(18(2)3)14-25(22)38-27)29(37)34-24(20-10-7-6-8-11-20)17-31-28(36)19(4)16-30/h12-14,18,20,23-24H,4-11,15,17H2,1-3H3,(H,31,36)(H,32,35)(H,34,37)/t23-,24+/m0/s1 |
| InChIKey | DQCBGARJXSCFLT-BJKOFHAPSA-N |
| XLogP | 4.51 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|