C25H32N4O2S — CID 167016906
2-cyano-N-[2-cyclohexyl-2-[3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanoylamino]ethyl]prop-2-enamide (PubChem CID 167016906) has the molecular formula C25H32N4O2S and a molecular weight of 452.62 g/mol. Its IUPAC name is 2-cyano-N-[2-cyclohexyl-2-[3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanoylamino]ethyl]prop-2-enamide.
| Compound Name | 2-cyano-N-[2-cyclohexyl-2-[3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanoylamino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 167016906 |
| Molecular Formula | C25H32N4O2S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 2-cyano-N-[2-cyclohexyl-2-[3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanoylamino]ethyl]prop-2-enamide |
| SMILES | C=C(C#N)C(=O)NCC(NC(=O)CCc1nc2ccc(C(C)C)cc2s1)C1CCCCC1 |
| InChI | InChI=1S/C25H32N4O2S/c1-16(2)19-9-10-20-22(13-19)32-24(29-20)12-11-23(30)28-21(18-7-5-4-6-8-18)15-27-25(31)17(3)14-26/h9-10,13,16,18,21H,3-8,11-12,15H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | MJIMATBMUNIXSO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|