C27H41N3OS — CID 142454789
N-[1-cyclohexyl-4-[(dimethylamino)methyl]pent-4-en-2-yl]-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide (PubChem CID 142454789) has the molecular formula C27H41N3OS and a molecular weight of 455.71 g/mol. Its IUPAC name is N-[1-cyclohexyl-4-[(dimethylamino)methyl]pent-4-en-2-yl]-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | N-[1-cyclohexyl-4-[(dimethylamino)methyl]pent-4-en-2-yl]-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 142454789 |
| Molecular Formula | C27H41N3OS |
| Molecular Weight | 455.71 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | N-[1-cyclohexyl-4-[(dimethylamino)methyl]pent-4-en-2-yl]-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide |
| SMILES | C=C(CC(CC1CCCCC1)NC(=O)CCc1nc2ccc(C(C)C)cc2s1)CN(C)C |
| InChI | InChI=1S/C27H41N3OS/c1-19(2)22-11-12-24-25(17-22)32-27(29-24)14-13-26(31)28-23(15-20(3)18-30(4)5)16-21-9-7-6-8-10-21/h11-12,17,19,21,23H,3,6-10,13-16,18H2,1-2,4-5H3,(H,28,31) |
| InChIKey | CPMQGHIMHGLFNL-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.71 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|