C23H31N3O3S2 — CID 142454508
N-[1-cyclohexyl-2-(ethynylsulfonylamino)ethyl]-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide (PubChem CID 142454508) has the molecular formula C23H31N3O3S2 and a molecular weight of 461.65 g/mol. Its IUPAC name is N-[1-cyclohexyl-2-(ethynylsulfonylamino)ethyl]-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | N-[1-cyclohexyl-2-(ethynylsulfonylamino)ethyl]-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 142454508 |
| Molecular Formula | C23H31N3O3S2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-[1-cyclohexyl-2-(ethynylsulfonylamino)ethyl]-3-(6-propan-2-yl-1,3-benzothiazol-2-yl)propanamide |
| SMILES | C#CS(=O)(=O)NCC(NC(=O)CCc1nc2ccc(C(C)C)cc2s1)C1CCCCC1 |
| InChI | InChI=1S/C23H31N3O3S2/c1-4-31(28,29)24-15-20(17-8-6-5-7-9-17)25-22(27)12-13-23-26-19-11-10-18(16(2)3)14-21(19)30-23/h1,10-11,14,16-17,20,24H,5-9,12-13,15H2,2-3H3,(H,25,27) |
| InChIKey | QESLPAPBANEUEH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|