C16H25NO2 — CID 142455262
1-[3-acetyl-5-(ethylamino)phenyl]-2-methylpropan-1-one;ethane (PubChem CID 142455262) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 1-[3-acetyl-5-(ethylamino)phenyl]-2-methylpropan-1-one;ethane.
| Compound Name | 1-[3-acetyl-5-(ethylamino)phenyl]-2-methylpropan-1-one;ethane |
|---|---|
| PubChem CID | 142455262 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 1-[3-acetyl-5-(ethylamino)phenyl]-2-methylpropan-1-one;ethane |
| SMILES | CC.CCNc1cc(C(C)=O)cc(C(=O)C(C)C)c1 |
| InChI | InChI=1S/C14H19NO2.C2H6/c1-5-15-13-7-11(10(4)16)6-12(8-13)14(17)9(2)3;1-2/h6-9,15H,5H2,1-4H3;1-2H3 |
| InChIKey | JQAYNBMXNJHGKN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |