C24H38N2O5 — CID 178048670
ethane;2-[[3-[(7-methyl-6-oxooctyl)amino]-5-(2-methylpropanoyl)benzoyl]amino]acetic acid (PubChem CID 178048670) has the molecular formula C24H38N2O5 and a molecular weight of 434.58 g/mol. Its IUPAC name is ethane;2-[[3-[(7-methyl-6-oxooctyl)amino]-5-(2-methylpropanoyl)benzoyl]amino]acetic acid.
| Compound Name | ethane;2-[[3-[(7-methyl-6-oxooctyl)amino]-5-(2-methylpropanoyl)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 178048670 |
| Molecular Formula | C24H38N2O5 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | ethane;2-[[3-[(7-methyl-6-oxooctyl)amino]-5-(2-methylpropanoyl)benzoyl]amino]acetic acid |
| SMILES | CC.CC(C)C(=O)CCCCCNc1cc(C(=O)NCC(=O)O)cc(C(=O)C(C)C)c1 |
| InChI | InChI=1S/C22H32N2O5.C2H6/c1-14(2)19(25)8-6-5-7-9-23-18-11-16(21(28)15(3)4)10-17(12-18)22(29)24-13-20(26)27;1-2/h10-12,14-15,23H,5-9,13H2,1-4H3,(H,24,29)(H,26,27);1-2H3 |
| InChIKey | IOYSBRPBBSQPKW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|