C15H19NO3 — CID 171414098
N-(6-methyl-2,5-dioxoheptyl)benzamide (PubChem CID 171414098) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-(6-methyl-2,5-dioxoheptyl)benzamide.
| Compound Name | N-(6-methyl-2,5-dioxoheptyl)benzamide |
|---|---|
| PubChem CID | 171414098 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | N-(6-methyl-2,5-dioxoheptyl)benzamide |
| SMILES | CC(C)C(=O)CCC(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H19NO3/c1-11(2)14(18)9-8-13(17)10-16-15(19)12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3,(H,16,19) |
| InChIKey | GZURJNWZKRSRBZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |